C16H27FN2O — CID 107113299
N-[[3-(aminomethyl)-2-fluorophenyl]methyl]-N-(2-methoxyethyl)pentan-3-amine (PubChem CID 107113299) has the molecular formula C16H27FN2O and a molecular weight of 282.40 g/mol. Its IUPAC name is N-[[3-(aminomethyl)-2-fluorophenyl]methyl]-N-(2-methoxyethyl)pentan-3-amine.
| Compound Name | N-[[3-(aminomethyl)-2-fluorophenyl]methyl]-N-(2-methoxyethyl)pentan-3-amine |
|---|---|
| PubChem CID | 107113299 |
| Molecular Formula | C16H27FN2O |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-[[3-(aminomethyl)-2-fluorophenyl]methyl]-N-(2-methoxyethyl)pentan-3-amine |
| SMILES | CCC(CC)N(CCOC)Cc1cccc(CN)c1F |
| InChI | InChI=1S/C16H27FN2O/c1-4-15(5-2)19(9-10-20-3)12-14-8-6-7-13(11-18)16(14)17/h6-8,15H,4-5,9-12,18H2,1-3H3 |
| InChIKey | NGENRMNYFBEIDI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |