C22H16BrF6N — CID 171614623
4-bromo-N,N-bis[[4-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 171614623) has the molecular formula C22H16BrF6N and a molecular weight of 488.27 g/mol. Its IUPAC name is 4-bromo-N,N-bis[[4-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 4-bromo-N,N-bis[[4-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 171614623 |
| Molecular Formula | C22H16BrF6N |
| Molecular Weight | 488.27 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 4-bromo-N,N-bis[[4-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | FC(F)(F)c1ccc(CN(Cc2ccc(C(F)(F)F)cc2)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H16BrF6N/c23-19-9-11-20(12-10-19)30(13-15-1-5-17(6-2-15)21(24,25)26)14-16-3-7-18(8-4-16)22(27,28)29/h1-12H,13-14H2 |
| InChIKey | UEEAQHKOTYXKIJ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.27 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |