C11H9F3N2O6S — CID 123807722
methyl 7-methoxy-5-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-2-carboxylate (PubChem CID 123807722) has the molecular formula C11H9F3N2O6S and a molecular weight of 354.26 g/mol. Its IUPAC name is methyl 7-methoxy-5-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-2-carboxylate.
| Compound Name | methyl 7-methoxy-5-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 123807722 |
| Molecular Formula | C11H9F3N2O6S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | methyl 7-methoxy-5-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(OS(=O)(=O)C(F)(F)F)cc(OC)n2n1 |
| InChI | InChI=1S/C11H9F3N2O6S/c1-20-9-5-7(22-23(18,19)11(12,13)14)3-6-4-8(10(17)21-2)15-16(6)9/h3-5H,1-2H3 |
| InChIKey | FXVFDUFGMRTKGH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|