C14H14F3NO5S — CID 137425656
(7,8-dimethoxy-1,6-dimethylisoquinolin-3-yl) trifluoromethanesulfonate (PubChem CID 137425656) has the molecular formula C14H14F3NO5S and a molecular weight of 365.33 g/mol. Its IUPAC name is (7,8-dimethoxy-1,6-dimethylisoquinolin-3-yl) trifluoromethanesulfonate.
| Compound Name | (7,8-dimethoxy-1,6-dimethylisoquinolin-3-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 137425656 |
| Molecular Formula | C14H14F3NO5S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | (7,8-dimethoxy-1,6-dimethylisoquinolin-3-yl) trifluoromethanesulfonate |
| SMILES | COc1c(C)cc2cc(OS(=O)(=O)C(F)(F)F)nc(C)c2c1OC |
| InChI | InChI=1S/C14H14F3NO5S/c1-7-5-9-6-10(23-24(19,20)14(15,16)17)18-8(2)11(9)13(22-4)12(7)21-3/h5-6H,1-4H3 |
| InChIKey | YFTXRYOQLVQKIQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|