C34H33FN6O2S — CID 169134767
1-[2-[7-(4-fluoro-2-propan-2-yloxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]prop-2-en-1-one (PubChem CID 169134767) has the molecular formula C34H33FN6O2S and a molecular weight of 608.74 g/mol. Its IUPAC name is 1-[2-[7-(4-fluoro-2-propan-2-yloxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[7-(4-fluoro-2-propan-2-yloxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169134767 |
| Molecular Formula | C34H33FN6O2S |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 1-[2-[7-(4-fluoro-2-propan-2-yloxyphenyl)-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCn2nc(-c3nc(-c4ccc5c(c4)CCN(C)C5)c4ccsc4c3-c3ccc(F)cc3OC(C)C)nc2C1 |
| InChI | InChI=1S/C34H33FN6O2S/c1-5-29(42)40-13-14-41-28(19-40)36-34(38-41)32-30(25-9-8-24(35)17-27(25)43-20(2)3)33-26(11-15-44-33)31(37-32)22-6-7-23-18-39(4)12-10-21(23)16-22/h5-9,11,15-17,20H,1,10,12-14,18-19H2,2-4H3 |
| InChIKey | BPNYDJUWHZHSAB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|