C32H29FN4O3S — CID 170095957
1-[2-[7-(4-fluoro-2-methoxyphenyl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]prop-2-en-1-ol (PubChem CID 170095957) has the molecular formula C32H29FN4O3S and a molecular weight of 568.67 g/mol. Its IUPAC name is 1-[2-[7-(4-fluoro-2-methoxyphenyl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]prop-2-en-1-ol.
| Compound Name | 1-[2-[7-(4-fluoro-2-methoxyphenyl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 170095957 |
| Molecular Formula | C32H29FN4O3S |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 1-[2-[7-(4-fluoro-2-methoxyphenyl)-4-(1,2,3,4-tetrahydroisoquinolin-6-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-[1,3]oxazolo[4,5-c]pyridin-5-yl]prop-2-en-1-ol |
| SMILES | C=CC(O)N1CCc2oc(-c3nc(-c4ccc5c(c4)CCNC5)c4ccsc4c3-c3ccc(F)cc3OC)nc2C1 |
| InChI | InChI=1S/C32H29FN4O3S/c1-3-27(38)37-12-9-25-24(17-37)35-32(40-25)30-28(22-7-6-21(33)15-26(22)39-2)31-23(10-13-41-31)29(36-30)19-4-5-20-16-34-11-8-18(20)14-19/h3-7,10,13-15,27,34,38H,1,8-9,11-12,16-17H2,2H3 |
| InChIKey | RONJYEALSIBGQO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|