C21H28F2N2O5 — CID 176700696
[(3R,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-(5-fluoro-2-propylphenoxy)ethoxy]ethyl]carbamate (PubChem CID 176700696) has the molecular formula C21H28F2N2O5 and a molecular weight of 426.46 g/mol. Its IUPAC name is [(3R,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-(5-fluoro-2-propylphenoxy)ethoxy]ethyl]carbamate.
| Compound Name | [(3R,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-(5-fluoro-2-propylphenoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176700696 |
| Molecular Formula | C21H28F2N2O5 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | [(3R,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] N-[2-[2-(5-fluoro-2-propylphenoxy)ethoxy]ethyl]carbamate |
| SMILES | C=CC(=O)N1C[C@H](F)[C@H](OC(=O)NCCOCCOc2cc(F)ccc2CCC)C1 |
| InChI | InChI=1S/C21H28F2N2O5/c1-3-5-15-6-7-16(22)12-18(15)29-11-10-28-9-8-24-21(27)30-19-14-25(13-17(19)23)20(26)4-2/h4,6-7,12,17,19H,2-3,5,8-11,13-14H2,1H3,(H,24,27)/t17-,19+/m0/s1 |
| InChIKey | IYMORAGRMUOCGQ-PKOBYXMFSA-N |
| XLogP | 2.63 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|