C12H13FN2O6 — CID 154697917
(2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate (PubChem CID 154697917) has the molecular formula C12H13FN2O6 and a molecular weight of 300.24 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate |
|---|---|
| PubChem CID | 154697917 |
| Molecular Formula | C12H13FN2O6 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate |
| SMILES | C=CC(=O)N1C[C@@H](F)[C@H](OC(=O)ON2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C12H13FN2O6/c1-2-9(16)14-5-7(13)8(6-14)20-12(19)21-15-10(17)3-4-11(15)18/h2,7-8H,1,3-6H2/t7-,8-/m1/s1 |
| InChIKey | HMFTXDYAVPVAGY-HTQZYQBOSA-N |
| XLogP | -0.06 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|