About (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate
(2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate (PubChem CID 154697917) has the molecular formula C12H13FN2O6
and a molecular weight of 300.24 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate |
| PubChem CID | 154697917 |
| Molecular Formula | C12H13FN2O6 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate |
| SMILES | C=CC(=O)N1C[C@@H](F)[C@H](OC(=O)ON2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C12H13FN2O6/c1-2-9(16)14-5-7(13)8(6-14)20-12(19)21-15-10(17)3-4-11(15)18/h2,7-8H,1,3-6H2/t7-,8-/m1/s1 |
| InChIKey | HMFTXDYAVPVAGY-HTQZYQBOSA-N |
| XLogP | -0.06 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate (CID 154697917) is (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate is C=CC(=O)N1C[C@@H](F)[C@H](OC(=O)ON2C(=O)CCC2=O)C1.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate?
The InChIKey is HMFTXDYAVPVAGY-HTQZYQBOSA-N. The full InChI is InChI=1S/C12H13FN2O6/c1-2-9(16)14-5-7(13)8(6-14)20-12(19)21-15-10(17)3-4-11(15)18/h2,7-8H,1,3-6H2/t7-,8-/m1/s1.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate?
(2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate has a molecular weight of 300.24 g/mol, XLogP of -0.06, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) [(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl] carbonate is sourced from PubChem (CID 154697917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).