C23H24F2N4O9 — CID 155759431
bis[(3R)-3-[(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-2,5-dioxopyrrolidin-1-yl] carbonate (PubChem CID 155759431) has the molecular formula C23H24F2N4O9 and a molecular weight of 538.46 g/mol. Its IUPAC name is bis[(3R)-3-[(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-2,5-dioxopyrrolidin-1-yl] carbonate.
| Compound Name | bis[(3R)-3-[(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-2,5-dioxopyrrolidin-1-yl] carbonate |
|---|---|
| PubChem CID | 155759431 |
| Molecular Formula | C23H24F2N4O9 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | bis[(3R)-3-[(3R,4R)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-2,5-dioxopyrrolidin-1-yl] carbonate |
| SMILES | C=CC(=O)N1C[C@@H]([C@H]2CC(=O)N(OC(=O)ON3C(=O)C[C@H]([C@@H]4CN(C(=O)C=C)C[C@@H]4F)C3=O)C2=O)[C@@H](F)C1 |
| InChI | InChI=1S/C23H24F2N4O9/c1-3-17(30)26-7-13(15(24)9-26)11-5-19(32)28(21(11)34)37-23(36)38-29-20(33)6-12(22(29)35)14-8-27(10-16(14)25)18(31)4-2/h3-4,11-16H,1-2,5-10H2/t11-,12-,13+,14+,15+,16+/m1/s1 |
| InChIKey | AYHHLMSAKGGADX-LGFJLYTPSA-N |
| XLogP | -0.32 |
| TPSA | 150.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|