C17H25BrN2O3 — CID 55848909
ethyl N-[1-[1-(4-bromophenyl)propan-2-ylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 55848909) has the molecular formula C17H25BrN2O3 and a molecular weight of 385.30 g/mol. Its IUPAC name is ethyl N-[1-[1-(4-bromophenyl)propan-2-ylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[1-(4-bromophenyl)propan-2-ylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 55848909 |
| Molecular Formula | C17H25BrN2O3 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | ethyl N-[1-[1-(4-bromophenyl)propan-2-ylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(C(=O)NC(C)Cc1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C17H25BrN2O3/c1-5-23-17(22)20-15(11(2)3)16(21)19-12(4)10-13-6-8-14(18)9-7-13/h6-9,11-12,15H,5,10H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | SZVLPBPHQZEIBE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |