C13H27NO4S — CID 81002609
tert-butyl (2R)-2-(butylsulfonylamino)-3-methylbutanoate (PubChem CID 81002609) has the molecular formula C13H27NO4S and a molecular weight of 293.43 g/mol. Its IUPAC name is tert-butyl (2R)-2-(butylsulfonylamino)-3-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-(butylsulfonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 81002609 |
| Molecular Formula | C13H27NO4S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | tert-butyl (2R)-2-(butylsulfonylamino)-3-methylbutanoate |
| SMILES | CCCCS(=O)(=O)N[C@@H](C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H27NO4S/c1-7-8-9-19(16,17)14-11(10(2)3)12(15)18-13(4,5)6/h10-11,14H,7-9H2,1-6H3/t11-/m1/s1 |
| InChIKey | JOHMUVBWOYLLRL-LLVKDONJSA-N |
| XLogP | 2.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |