C12H24N2O6S — CID 18654134
(2S)-2-(butylsulfonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 18654134) has the molecular formula C12H24N2O6S and a molecular weight of 324.40 g/mol. Its IUPAC name is (2S)-2-(butylsulfonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-2-(butylsulfonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 18654134 |
| Molecular Formula | C12H24N2O6S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2S)-2-(butylsulfonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CCCCS(=O)(=O)N[C@@H](CNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H24N2O6S/c1-5-6-7-21(18,19)14-9(10(15)16)8-13-11(17)20-12(2,3)4/h9,14H,5-8H2,1-4H3,(H,13,17)(H,15,16)/t9-/m0/s1 |
| InChIKey | JCORZAXFKRZWMU-VIFPVBQESA-N |
| XLogP | 0.68 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |