C14H27N3O5 — CID 59855908
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(pentylcarbamoylamino)propanoic acid (PubChem CID 59855908) has the molecular formula C14H27N3O5 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(pentylcarbamoylamino)propanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(pentylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 59855908 |
| Molecular Formula | C14H27N3O5 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(pentylcarbamoylamino)propanoic acid |
| SMILES | CCCCCNC(=O)NC[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H27N3O5/c1-5-6-7-8-15-12(20)16-9-10(11(18)19)17-13(21)22-14(2,3)4/h10H,5-9H2,1-4H3,(H,17,21)(H,18,19)(H2,15,16,20)/t10-/m0/s1 |
| InChIKey | LHMZMLRQUYYGPH-JTQLQIEISA-N |
| XLogP | 1.45 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|