C10H22N2O4S — CID 59913383
tert-butyl (2R)-3-amino-2-(propylsulfonylamino)propanoate (PubChem CID 59913383) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is tert-butyl (2R)-3-amino-2-(propylsulfonylamino)propanoate.
| Compound Name | tert-butyl (2R)-3-amino-2-(propylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 59913383 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | tert-butyl (2R)-3-amino-2-(propylsulfonylamino)propanoate |
| SMILES | CCCS(=O)(=O)N[C@H](CN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H22N2O4S/c1-5-6-17(14,15)12-8(7-11)9(13)16-10(2,3)4/h8,12H,5-7,11H2,1-4H3/t8-/m1/s1 |
| InChIKey | BPOGKMHDWVSYBA-MRVPVSSYSA-N |
| XLogP | -0.02 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |