C15H19N3O8S — CID 139969284
4-[2-methoxy-1-[(4-nitrophenyl)sulfonylamino]-2-oxoethyl]piperidine-1-carboxylic acid (PubChem CID 139969284) has the molecular formula C15H19N3O8S and a molecular weight of 401.40 g/mol. Its IUPAC name is 4-[2-methoxy-1-[(4-nitrophenyl)sulfonylamino]-2-oxoethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-methoxy-1-[(4-nitrophenyl)sulfonylamino]-2-oxoethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 139969284 |
| Molecular Formula | C15H19N3O8S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-[2-methoxy-1-[(4-nitrophenyl)sulfonylamino]-2-oxoethyl]piperidine-1-carboxylic acid |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C15H19N3O8S/c1-26-14(19)13(10-6-8-17(9-7-10)15(20)21)16-27(24,25)12-4-2-11(3-5-12)18(22)23/h2-5,10,13,16H,6-9H2,1H3,(H,20,21) |
| InChIKey | JGKLZNDFPLXHER-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|