C21H27NO5S — CID 70236207
ethyl (2R)-2-(3-hydroxycycloheptyl)-2-(naphthalen-2-ylsulfonylamino)acetate (PubChem CID 70236207) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is ethyl (2R)-2-(3-hydroxycycloheptyl)-2-(naphthalen-2-ylsulfonylamino)acetate.
| Compound Name | ethyl (2R)-2-(3-hydroxycycloheptyl)-2-(naphthalen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 70236207 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | ethyl (2R)-2-(3-hydroxycycloheptyl)-2-(naphthalen-2-ylsulfonylamino)acetate |
| SMILES | CCOC(=O)[C@H](NS(=O)(=O)c1ccc2ccccc2c1)C1CCCCC(O)C1 |
| InChI | InChI=1S/C21H27NO5S/c1-2-27-21(24)20(17-9-5-6-10-18(23)13-17)22-28(25,26)19-12-11-15-7-3-4-8-16(15)14-19/h3-4,7-8,11-12,14,17-18,20,22-23H,2,5-6,9-10,13H2,1H3/t17?,18?,20-/m1/s1 |
| InChIKey | AGOZEFBSAHQNCO-AFMYVXGZSA-N |
| XLogP | 2.99 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |