C26H28F3N3O5 — CID 20662291
naphthalen-2-yl (2S)-5-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]pentanoate;2,2,2-trifluoroacetic acid (PubChem CID 20662291) has the molecular formula C26H28F3N3O5 and a molecular weight of 519.52 g/mol. Its IUPAC name is naphthalen-2-yl (2S)-5-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]pentanoate;2,2,2-trifluoroacetic acid.
| Compound Name | naphthalen-2-yl (2S)-5-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]pentanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 20662291 |
| Molecular Formula | C26H28F3N3O5 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | naphthalen-2-yl (2S)-5-amino-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]pentanoate;2,2,2-trifluoroacetic acid |
| SMILES | NCCC[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)Oc1ccc2ccccc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H27N3O3.C2HF3O2/c25-14-6-11-22(27-23(28)21(26)15-17-7-2-1-3-8-17)24(29)30-20-13-12-18-9-4-5-10-19(18)16-20;3-2(4,5)1(6)7/h1-5,7-10,12-13,16,21-22H,6,11,14-15,25-26H2,(H,27,28);(H,6,7)/t21-,22-;/m0./s1 |
| InChIKey | RYDRNTZLXFFHFT-VROPFNGYSA-N |
| XLogP | 3.17 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|