C28H44N8O8 — CID 166919819
2-[(2-acetamidoacetyl)amino]-N-[2-[[(2S)-6-amino-1-[[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]amino]-1-oxohexan-2-yl]amino]-2-oxoethyl]pentanediamide (PubChem CID 166919819) has the molecular formula C28H44N8O8 and a molecular weight of 620.71 g/mol. Its IUPAC name is 2-[(2-acetamidoacetyl)amino]-N-[2-[[(2S)-6-amino-1-[[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]amino]-1-oxohexan-2-yl]amino]-2-oxoethyl]pentanediamide.
| Compound Name | 2-[(2-acetamidoacetyl)amino]-N-[2-[[(2S)-6-amino-1-[[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]amino]-1-oxohexan-2-yl]amino]-2-oxoethyl]pentanediamide |
|---|---|
| PubChem CID | 166919819 |
| Molecular Formula | C28H44N8O8 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | 2-[(2-acetamidoacetyl)amino]-N-[2-[[(2S)-6-amino-1-[[2-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-oxoethyl]amino]-1-oxohexan-2-yl]amino]-2-oxoethyl]pentanediamide |
| SMILES | CC(=O)NCC(=O)NC(CCC(N)=O)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)NCC(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C28H44N8O8/c1-18(38)31-14-25(41)36-22(10-11-23(30)39)28(44)33-16-26(42)35-21(9-5-6-12-29)27(43)32-15-24(40)34-20(17-37)13-19-7-3-2-4-8-19/h2-4,7-8,20-22,37H,5-6,9-17,29H2,1H3,(H2,30,39)(H,31,38)(H,32,43)(H,33,44)(H,34,40)(H,35,42)(H,36,41)/t20?,21-,22?/m0/s1 |
| InChIKey | GHXLDMRDLNXRSP-ORFBVSJDSA-N |
| XLogP | -3.56 |
| TPSA | 263.94 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|