C34H35F3N6O3 — CID 16728334
N-[[4-[(2S)-2-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]phenyl]methyl]-4-(trifluoromethyl)benzamide (PubChem CID 16728334) has the molecular formula C34H35F3N6O3 and a molecular weight of 632.69 g/mol. Its IUPAC name is N-[[4-[(2S)-2-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]phenyl]methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[[4-[(2S)-2-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]phenyl]methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 16728334 |
| Molecular Formula | C34H35F3N6O3 |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | N-[[4-[(2S)-2-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]phenyl]methyl]-4-(trifluoromethyl)benzamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H](N)Cc1ccc2ccccc2c1)C(=O)c1ccc(CNC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H35F3N6O3/c35-34(36,37)27-15-13-25(14-16-27)31(45)42-20-21-7-11-24(12-8-21)30(44)29(6-3-17-41-33(39)40)43-32(46)28(38)19-22-9-10-23-4-1-2-5-26(23)18-22/h1-2,4-5,7-16,18,28-29H,3,6,17,19-20,38H2,(H,42,45)(H,43,46)(H4,39,40,41)/t28-,29-/m0/s1 |
| InChIKey | FKFYEZUHJHTOSV-VMPREFPWSA-N |
| XLogP | 4.08 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|