C33H47N9O5 — CID 174579622
2-amino-3-(1H-indol-3-yl)propanoic acid;2,6-diaminohexanamide;5-(diaminomethylideneamino)-2-(naphthalen-2-ylamino)pentanoic acid (PubChem CID 174579622) has the molecular formula C33H47N9O5 and a molecular weight of 649.80 g/mol. Its IUPAC name is 2-amino-3-(1H-indol-3-yl)propanoic acid;2,6-diaminohexanamide;5-(diaminomethylideneamino)-2-(naphthalen-2-ylamino)pentanoic acid.
| Compound Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;2,6-diaminohexanamide;5-(diaminomethylideneamino)-2-(naphthalen-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 174579622 |
| Molecular Formula | C33H47N9O5 |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.37 |
| IUPAC Name | 2-amino-3-(1H-indol-3-yl)propanoic acid;2,6-diaminohexanamide;5-(diaminomethylideneamino)-2-(naphthalen-2-ylamino)pentanoic acid |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)O.NC(N)=NCCCC(Nc1ccc2ccccc2c1)C(=O)O.NCCCCC(N)C(N)=O |
| InChI | InChI=1S/C16H20N4O2.C11H12N2O2.C6H15N3O/c17-16(18)19-9-3-6-14(15(21)22)20-13-8-7-11-4-1-2-5-12(11)10-13;12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;7-4-2-1-3-5(8)6(9)10/h1-2,4-5,7-8,10,14,20H,3,6,9H2,(H,21,22)(H4,17,18,19);1-4,6,9,13H,5,12H2,(H,14,15);5H,1-4,7-8H2,(H2,9,10) |
| InChIKey | SHBGPDFJWSATMY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 287.97 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|