C22H41BN6O6 — CID 58301560
[(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-12-cyano-4-oxododecanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58301560) has the molecular formula C22H41BN6O6 and a molecular weight of 496.42 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-12-cyano-4-oxododecanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-12-cyano-4-oxododecanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58301560 |
| Molecular Formula | C22H41BN6O6 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-12-cyano-4-oxododecanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])CC(=O)CCCCCCCCC#N)B(O)O |
| InChI | InChI=1S/C22H41BN6O6/c1-17(2)15-20(23(32)33)27-21(31)18(11-10-14-26-22(25)28-29(34)35)16-19(30)12-8-6-4-3-5-7-9-13-24/h17-18,20,32-33H,3-12,14-16H2,1-2H3,(H,27,31)(H3,25,26,28)/t18-,20+/m1/s1 |
| InChIKey | ZHRISTYKJJBZHU-QUCCMNQESA-N |
| XLogP | 1.63 |
| TPSA | 203.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|