C32H47BN6O8 — CID 159378822
[(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxoheptanoyl]amino]-3-methylbutyl]boronic acid;methane (PubChem CID 159378822) has the molecular formula C32H47BN6O8 and a molecular weight of 654.57 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxoheptanoyl]amino]-3-methylbutyl]boronic acid;methane.
| Compound Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxoheptanoyl]amino]-3-methylbutyl]boronic acid;methane |
|---|---|
| PubChem CID | 159378822 |
| Molecular Formula | C32H47BN6O8 |
| Molecular Weight | 654.57 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-7-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxoheptanoyl]amino]-3-methylbutyl]boronic acid;methane |
| SMILES | C.CC(C)C[C@H](NC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])CC(=O)CCCNC(=O)OCC1c2ccccc2-c2ccccc21)B(O)O |
| InChI | InChI=1S/C31H43BN6O8.CH4/c1-20(2)17-28(32(42)43)36-29(40)21(9-7-15-34-30(33)37-38(44)45)18-22(39)10-8-16-35-31(41)46-19-27-25-13-5-3-11-23(25)24-12-4-6-14-26(24)27;/h3-6,11-14,20-21,27-28,42-43H,7-10,15-19H2,1-2H3,(H,35,41)(H,36,40)(H3,33,34,37);1H4/t21-,28+;/m1./s1 |
| InChIKey | LKQOFEKQRPYAHO-YKOZSTOFSA-N |
| XLogP | 2.94 |
| TPSA | 218.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|