C22H34BN5O7 — CID 58301667
[(1R)-1-[[(E,2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-6-(2-methoxyphenyl)-4-oxohex-5-enoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58301667) has the molecular formula C22H34BN5O7 and a molecular weight of 491.35 g/mol. Its IUPAC name is [(1R)-1-[[(E,2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-6-(2-methoxyphenyl)-4-oxohex-5-enoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(E,2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-6-(2-methoxyphenyl)-4-oxohex-5-enoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58301667 |
| Molecular Formula | C22H34BN5O7 |
| Molecular Weight | 491.35 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | [(1R)-1-[[(E,2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-6-(2-methoxyphenyl)-4-oxohex-5-enoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | COc1ccccc1/C=C/C(=O)CC(CCC/N=C(\N)N[N+](=O)[O-])C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C22H34BN5O7/c1-15(2)13-20(23(31)32)26-21(30)17(8-6-12-25-22(24)27-28(33)34)14-18(29)11-10-16-7-4-5-9-19(16)35-3/h4-5,7,9-11,15,17,20,31-32H,6,8,12-14H2,1-3H3,(H,26,30)(H3,24,25,27)/b11-10+/t17?,20-/m0/s1 |
| InChIKey | FHNSSOXVPBRMGI-JFXAXUHDSA-N |
| XLogP | 0.70 |
| TPSA | 189.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|