C25H40BN5O6 — CID 158010377
[(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-6-(3H-inden-1-yl)-4-oxohexanoyl]amino]-3-methylbutyl]boronic acid;methane (PubChem CID 158010377) has the molecular formula C25H40BN5O6 and a molecular weight of 517.44 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-6-(3H-inden-1-yl)-4-oxohexanoyl]amino]-3-methylbutyl]boronic acid;methane.
| Compound Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-6-(3H-inden-1-yl)-4-oxohexanoyl]amino]-3-methylbutyl]boronic acid;methane |
|---|---|
| PubChem CID | 158010377 |
| Molecular Formula | C25H40BN5O6 |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-6-(3H-inden-1-yl)-4-oxohexanoyl]amino]-3-methylbutyl]boronic acid;methane |
| SMILES | C.CC(C)C[C@H](NC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])CC(=O)CCC1=CCc2ccccc21)B(O)O |
| InChI | InChI=1S/C24H36BN5O6.CH4/c1-16(2)14-22(25(33)34)28-23(32)19(7-5-13-27-24(26)29-30(35)36)15-20(31)12-11-18-10-9-17-6-3-4-8-21(17)18;/h3-4,6,8,10,16,19,22,33-34H,5,7,9,11-15H2,1-2H3,(H,28,32)(H3,26,27,29);1H4/t19-,22+;/m1./s1 |
| InChIKey | FEUSVXPLWQTQOO-GVWAYPJCSA-N |
| XLogP | 2.04 |
| TPSA | 180.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|