C19H38BN5O6 — CID 58302026
[(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-8-methyl-4-oxononanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58302026) has the molecular formula C19H38BN5O6 and a molecular weight of 443.35 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-8-methyl-4-oxononanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-8-methyl-4-oxononanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58302026 |
| Molecular Formula | C19H38BN5O6 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-8-methyl-4-oxononanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)CCCC(=O)CC(CCC/N=C(\N)N[N+](=O)[O-])C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C19H38BN5O6/c1-13(2)7-5-9-16(26)12-15(8-6-10-22-19(21)24-25(30)31)18(27)23-17(20(28)29)11-14(3)4/h13-15,17,28-29H,5-12H2,1-4H3,(H,23,27)(H3,21,22,24)/t15?,17-/m0/s1 |
| InChIKey | INJDVAMGKGHXSP-LWKPJOBUSA-N |
| XLogP | 0.81 |
| TPSA | 180.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|