C19H34BN5O6S — CID 159431271
[(1R)-1-[[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[2-(5-methylthiophen-2-yl)-2-oxoethyl]pentanoyl]amino]-3-methylbutyl]boronic acid;methane (PubChem CID 159431271) has the molecular formula C19H34BN5O6S and a molecular weight of 471.39 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[2-(5-methylthiophen-2-yl)-2-oxoethyl]pentanoyl]amino]-3-methylbutyl]boronic acid;methane.
| Compound Name | [(1R)-1-[[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[2-(5-methylthiophen-2-yl)-2-oxoethyl]pentanoyl]amino]-3-methylbutyl]boronic acid;methane |
|---|---|
| PubChem CID | 159431271 |
| Molecular Formula | C19H34BN5O6S |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | [(1R)-1-[[(2R)-5-[[amino(nitramido)methylidene]amino]-2-[2-(5-methylthiophen-2-yl)-2-oxoethyl]pentanoyl]amino]-3-methylbutyl]boronic acid;methane |
| SMILES | C.Cc1ccc(C(=O)C[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)N[C@@H](CC(C)C)B(O)O)s1 |
| InChI | InChI=1S/C18H30BN5O6S.CH4/c1-11(2)9-16(19(27)28)22-17(26)13(5-4-8-21-18(20)23-24(29)30)10-14(25)15-7-6-12(3)31-15;/h6-7,11,13,16,27-28H,4-5,8-10H2,1-3H3,(H,22,26)(H3,20,21,23);1H4/t13-,16+;/m1./s1 |
| InChIKey | LRAADNYWIAUAIH-CACIRBSMSA-N |
| XLogP | 1.30 |
| TPSA | 180.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|