C35H55BN6O8 — CID 58301678
[(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-5-cyclopentyl-13-(1,3-dioxoisoindol-2-yl)-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58301678) has the molecular formula C35H55BN6O8 and a molecular weight of 698.67 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-5-cyclopentyl-13-(1,3-dioxoisoindol-2-yl)-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-5-cyclopentyl-13-(1,3-dioxoisoindol-2-yl)-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58301678 |
| Molecular Formula | C35H55BN6O8 |
| Molecular Weight | 698.67 g/mol |
| Exact Mass | 698.42 |
| IUPAC Name | [(1R)-1-[[(2R)-2-[3-[[amino(nitramido)methylidene]amino]propyl]-5-cyclopentyl-13-(1,3-dioxoisoindol-2-yl)-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)C(CCC/N=C(\N)N[N+](=O)[O-])CC(=O)C(CCCCCCCCN1C(=O)c2ccccc2C1=O)C1CCCC1)B(O)O |
| InChI | InChI=1S/C35H55BN6O8/c1-24(2)22-31(36(47)48)39-32(44)26(16-13-20-38-35(37)40-42(49)50)23-30(43)27(25-14-8-9-15-25)17-7-5-3-4-6-12-21-41-33(45)28-18-10-11-19-29(28)34(41)46/h10-11,18-19,24-27,31,47-48H,3-9,12-17,20-23H2,1-2H3,(H,39,44)(H3,37,38,40)/t26?,27?,31-/m0/s1 |
| InChIKey | UOZXQPQYMBQZCN-OXVIYWBMSA-N |
| XLogP | 3.81 |
| TPSA | 217.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|