C21H40BN7O5 — CID 143005394
[(1R)-1-[[(2S)-5-[[amino-(2-oxohydrazinyl)methylidene]amino]-2-(9-cyanononanoylamino)pentanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 143005394) has the molecular formula C21H40BN7O5 and a molecular weight of 481.41 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-5-[[amino-(2-oxohydrazinyl)methylidene]amino]-2-(9-cyanononanoylamino)pentanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-5-[[amino-(2-oxohydrazinyl)methylidene]amino]-2-(9-cyanononanoylamino)pentanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 143005394 |
| Molecular Formula | C21H40BN7O5 |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | [(1R)-1-[[(2S)-5-[[amino-(2-oxohydrazinyl)methylidene]amino]-2-(9-cyanononanoylamino)pentanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC/N=C(\N)NN=O)NC(=O)CCCCCCCCC#N)B(O)O |
| InChI | InChI=1S/C21H40BN7O5/c1-16(2)15-18(22(32)33)27-20(31)17(11-10-14-25-21(24)28-29-34)26-19(30)12-8-6-4-3-5-7-9-13-23/h16-18,32-33H,3-12,14-15H2,1-2H3,(H,26,30)(H,27,31)(H3,24,25,28,34)/t17-,18-/m0/s1 |
| InChIKey | AJPHXYZPSSRYKO-ROUUACIJSA-N |
| XLogP | 1.02 |
| TPSA | 202.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|