C30H46BN7O7 — CID 143005407
[1-[[(2S)-5-[[amino-(2-oxohydrazinyl)methylidene]amino]-2-[10-(1,3-dioxoisoindol-2-yl)decanoylamino]pentanoyl]amino]-2-propan-2-ylcyclopropyl]boronic acid (PubChem CID 143005407) has the molecular formula C30H46BN7O7 and a molecular weight of 627.55 g/mol. Its IUPAC name is [1-[[(2S)-5-[[amino-(2-oxohydrazinyl)methylidene]amino]-2-[10-(1,3-dioxoisoindol-2-yl)decanoylamino]pentanoyl]amino]-2-propan-2-ylcyclopropyl]boronic acid.
| Compound Name | [1-[[(2S)-5-[[amino-(2-oxohydrazinyl)methylidene]amino]-2-[10-(1,3-dioxoisoindol-2-yl)decanoylamino]pentanoyl]amino]-2-propan-2-ylcyclopropyl]boronic acid |
|---|---|
| PubChem CID | 143005407 |
| Molecular Formula | C30H46BN7O7 |
| Molecular Weight | 627.55 g/mol |
| Exact Mass | 627.36 |
| IUPAC Name | [1-[[(2S)-5-[[amino-(2-oxohydrazinyl)methylidene]amino]-2-[10-(1,3-dioxoisoindol-2-yl)decanoylamino]pentanoyl]amino]-2-propan-2-ylcyclopropyl]boronic acid |
| SMILES | CC(C)C1CC1(NC(=O)[C@H](CCC/N=C(\N)NN=O)NC(=O)CCCCCCCCCN1C(=O)c2ccccc2C1=O)B(O)O |
| InChI | InChI=1S/C30H46BN7O7/c1-20(2)23-19-30(23,31(43)44)35-26(40)24(15-12-17-33-29(32)36-37-45)34-25(39)16-8-6-4-3-5-7-11-18-38-27(41)21-13-9-10-14-22(21)28(38)42/h9-10,13-14,20,23-24,43-44H,3-8,11-12,15-19H2,1-2H3,(H,34,39)(H,35,40)(H3,32,33,36,45)/t23?,24-,30?/m0/s1 |
| InChIKey | RAHLTERIIGOJGQ-YNWJMLEKSA-N |
| XLogP | 1.80 |
| TPSA | 215.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|