C26H38N2O3 — CID 56736911
7-(1,3-dioxoisoindol-2-yl)-N-[1-(4-propylcyclohexyl)ethyl]heptanamide (PubChem CID 56736911) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is 7-(1,3-dioxoisoindol-2-yl)-N-[1-(4-propylcyclohexyl)ethyl]heptanamide.
| Compound Name | 7-(1,3-dioxoisoindol-2-yl)-N-[1-(4-propylcyclohexyl)ethyl]heptanamide |
|---|---|
| PubChem CID | 56736911 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 7-(1,3-dioxoisoindol-2-yl)-N-[1-(4-propylcyclohexyl)ethyl]heptanamide |
| SMILES | CCCC1CCC(C(C)NC(=O)CCCCCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C26H38N2O3/c1-3-10-20-14-16-21(17-15-20)19(2)27-24(29)13-6-4-5-9-18-28-25(30)22-11-7-8-12-23(22)26(28)31/h7-8,11-12,19-21H,3-6,9-10,13-18H2,1-2H3,(H,27,29) |
| InChIKey | QGVZRMLLKPOPCV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|