C24H35N7O5S — CID 54344499
(2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-3-methylbutanoyl]amino]pentanamide (PubChem CID 54344499) has the molecular formula C24H35N7O5S and a molecular weight of 533.66 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-3-methylbutanoyl]amino]pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-3-methylbutanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 54344499 |
| Molecular Formula | C24H35N7O5S |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-3-methylbutanoyl]amino]pentanamide |
| SMILES | CC(C)[C@H](NC(=O)C(S)CCCN1C(=O)c2ccccc2C1=O)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C24H35N7O5S/c1-13(2)18(21(34)29-16(19(25)32)9-5-11-28-24(26)27)30-20(33)17(37)10-6-12-31-22(35)14-7-3-4-8-15(14)23(31)36/h3-4,7-8,13,16-18,37H,5-6,9-12H2,1-2H3,(H2,25,32)(H,29,34)(H,30,33)(H4,26,27,28)/t16-,17?,18-/m0/s1 |
| InChIKey | UBIKKTQDIKRJTM-RGBJRUIASA-N |
| XLogP | -0.47 |
| TPSA | 203.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|