C23H48BN5O5 — CID 90088258
[(1R)-3-methyl-1-[[(2S)-5-[(N'-methylcarbamimidoyl)amino]-2-(3-octoxypropanoylamino)pentanoyl]amino]butyl]boronic acid (PubChem CID 90088258) has the molecular formula C23H48BN5O5 and a molecular weight of 485.48 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(2S)-5-[(N'-methylcarbamimidoyl)amino]-2-(3-octoxypropanoylamino)pentanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(2S)-5-[(N'-methylcarbamimidoyl)amino]-2-(3-octoxypropanoylamino)pentanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 90088258 |
| Molecular Formula | C23H48BN5O5 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.37 |
| IUPAC Name | [(1R)-3-methyl-1-[[(2S)-5-[(N'-methylcarbamimidoyl)amino]-2-(3-octoxypropanoylamino)pentanoyl]amino]butyl]boronic acid |
| SMILES | CCCCCCCCOCCC(=O)N[C@@H](CCCN/C(N)=N/C)C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C23H48BN5O5/c1-5-6-7-8-9-10-15-34-16-13-21(30)28-19(12-11-14-27-23(25)26-4)22(31)29-20(24(32)33)17-18(2)3/h18-20,32-33H,5-17H2,1-4H3,(H,28,30)(H,29,31)(H3,25,26,27)/t19-,20-/m0/s1 |
| InChIKey | WWMBCMPBVZZEOJ-PMACEKPBSA-N |
| XLogP | 1.10 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|