C22H42N8O5 — CID 101371457
(2S)-2-[[2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]acetyl]amino]-N-[(2S)-1-amino-5-[(N'-methylcarbamimidoyl)amino]-1-oxopentan-2-yl]-4-methylpentanamide (PubChem CID 101371457) has the molecular formula C22H42N8O5 and a molecular weight of 498.63 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]acetyl]amino]-N-[(2S)-1-amino-5-[(N'-methylcarbamimidoyl)amino]-1-oxopentan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]acetyl]amino]-N-[(2S)-1-amino-5-[(N'-methylcarbamimidoyl)amino]-1-oxopentan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 101371457 |
| Molecular Formula | C22H42N8O5 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]acetyl]amino]-N-[(2S)-1-amino-5-[(N'-methylcarbamimidoyl)amino]-1-oxopentan-2-yl]-4-methylpentanamide |
| SMILES | C/N=C(\N)NCCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@@H](NC(C)=O)C(C)C)C(N)=O |
| InChI | InChI=1S/C22H42N8O5/c1-12(2)10-16(20(34)30-15(19(23)33)8-7-9-26-22(24)25-6)29-17(32)11-27-21(35)18(13(3)4)28-14(5)31/h12-13,15-16,18H,7-11H2,1-6H3,(H2,23,33)(H,27,35)(H,28,31)(H,29,32)(H,30,34)(H3,24,25,26)/t15-,16-,18-/m0/s1 |
| InChIKey | LLYHVYVZKJAZKL-BQFCYCMXSA-N |
| XLogP | -1.92 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|