C19H29N7O4 — CID 163535538
N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-5-[(N'-methylcarbamimidoyl)amino]-2-[(2-phenylacetyl)amino]pentanamide (PubChem CID 163535538) has the molecular formula C19H29N7O4 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-5-[(N'-methylcarbamimidoyl)amino]-2-[(2-phenylacetyl)amino]pentanamide.
| Compound Name | N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-5-[(N'-methylcarbamimidoyl)amino]-2-[(2-phenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 163535538 |
| Molecular Formula | C19H29N7O4 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-5-[(N'-methylcarbamimidoyl)amino]-2-[(2-phenylacetyl)amino]pentanamide |
| SMILES | C/N=C(\N)NCCCC(NC(=O)Cc1ccccc1)C(=O)NCC(=O)NCC(N)=O |
| InChI | InChI=1S/C19H29N7O4/c1-22-19(21)23-9-5-8-14(18(30)25-12-17(29)24-11-15(20)27)26-16(28)10-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3,(H2,20,27)(H,24,29)(H,25,30)(H,26,28)(H3,21,22,23) |
| InChIKey | DWQLZSOGQYEZRH-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|