C21H39N5O3S — CID 157231787
benzyl (2S)-2-[[(2R)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-4-methylpentanoate;methane;sulfane (PubChem CID 157231787) has the molecular formula C21H39N5O3S and a molecular weight of 441.64 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2R)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-4-methylpentanoate;methane;sulfane.
| Compound Name | benzyl (2S)-2-[[(2R)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-4-methylpentanoate;methane;sulfane |
|---|---|
| PubChem CID | 157231787 |
| Molecular Formula | C21H39N5O3S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | benzyl (2S)-2-[[(2R)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-4-methylpentanoate;methane;sulfane |
| SMILES | C.C/N=C(\N)NCCC[C@@H](N)C(=O)N[C@@H](CC(C)C)C(=O)OCc1ccccc1.S |
| InChI | InChI=1S/C20H33N5O3.CH4.H2S/c1-14(2)12-17(19(27)28-13-15-8-5-4-6-9-15)25-18(26)16(21)10-7-11-24-20(22)23-3;;/h4-6,8-9,14,16-17H,7,10-13,21H2,1-3H3,(H,25,26)(H3,22,23,24);1H4;1H2/t16-,17+;;/m1../s1 |
| InChIKey | AUEPLUFZLXVYNT-LWPKXAGOSA-N |
| XLogP | 1.65 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|