C19H28N6O3 — CID 58658477
methyl (2S)-2-[[(2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 58658477) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 58658477 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | C/N=C(\N)NCCC[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OC |
| InChI | InChI=1S/C19H28N6O3/c1-22-19(21)23-9-5-7-14(20)17(26)25-16(18(27)28-2)10-12-11-24-15-8-4-3-6-13(12)15/h3-4,6,8,11,14,16,24H,5,7,9-10,20H2,1-2H3,(H,25,26)(H3,21,22,23)/t14-,16-/m0/s1 |
| InChIKey | UIQPUGGMXCKPET-HOCLYGCPSA-N |
| XLogP | 0.01 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|