C29H36N6O7 — CID 10483341
methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 10483341) has the molecular formula C29H36N6O7 and a molecular weight of 580.64 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 10483341 |
| Molecular Formula | C29H36N6O7 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5-(carbamoylamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(C)=O |
| InChI | InChI=1S/C29H36N6O7/c1-17(36)33-24(15-19-16-32-22-7-4-3-6-21(19)22)27(39)34-23(8-5-13-31-29(30)41)26(38)35-25(28(40)42-2)14-18-9-11-20(37)12-10-18/h3-4,6-7,9-12,16,23-25,32,37H,5,8,13-15H2,1-2H3,(H,33,36)(H,34,39)(H,35,38)(H3,30,31,41)/t23-,24-,25-/m0/s1 |
| InChIKey | OMXNJIYGMSICTF-SDHOMARFSA-N |
| XLogP | 0.75 |
| TPSA | 204.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|