C19H28N4O4 — CID 56662598
methyl (2S)-2-[[(2S,3S)-3,7-diamino-2-hydroxyheptanoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 56662598) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,3S)-3,7-diamino-2-hydroxyheptanoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S,3S)-3,7-diamino-2-hydroxyheptanoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 56662598 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | methyl (2S)-2-[[(2S,3S)-3,7-diamino-2-hydroxyheptanoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C19H28N4O4/c1-27-19(26)16(10-12-11-22-15-8-3-2-6-13(12)15)23-18(25)17(24)14(21)7-4-5-9-20/h2-3,6,8,11,14,16-17,22,24H,4-5,7,9-10,20-21H2,1H3,(H,23,25)/t14-,16-,17-/m0/s1 |
| InChIKey | CGMUBURMPMVFHE-XIRDDKMYSA-N |
| XLogP | 0.19 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|