C21H38ClN5O3S — CID 161035254
(4-chlorophenyl)methyl (2S)-2-[[(2R)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-4-methylpentanoate;methane;sulfane (PubChem CID 161035254) has the molecular formula C21H38ClN5O3S and a molecular weight of 476.09 g/mol. Its IUPAC name is (4-chlorophenyl)methyl (2S)-2-[[(2R)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-4-methylpentanoate;methane;sulfane.
| Compound Name | (4-chlorophenyl)methyl (2S)-2-[[(2R)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-4-methylpentanoate;methane;sulfane |
|---|---|
| PubChem CID | 161035254 |
| Molecular Formula | C21H38ClN5O3S |
| Molecular Weight | 476.09 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (4-chlorophenyl)methyl (2S)-2-[[(2R)-2-amino-5-[(N'-methylcarbamimidoyl)amino]pentanoyl]amino]-4-methylpentanoate;methane;sulfane |
| SMILES | C.C/N=C(\N)NCCC[C@@H](N)C(=O)N[C@@H](CC(C)C)C(=O)OCc1ccc(Cl)cc1.S |
| InChI | InChI=1S/C20H32ClN5O3.CH4.H2S/c1-13(2)11-17(19(28)29-12-14-6-8-15(21)9-7-14)26-18(27)16(22)5-4-10-25-20(23)24-3;;/h6-9,13,16-17H,4-5,10-12,22H2,1-3H3,(H,26,27)(H3,23,24,25);1H4;1H2/t16-,17+;;/m1../s1 |
| InChIKey | UADZDUOPNOHPLL-LWPKXAGOSA-N |
| XLogP | 2.30 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.09 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|