C28H39N5O7 — CID 166689374
(Z)-N-[2-[[2-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]-7-methyl-8,11-dioxododec-9-enamide (PubChem CID 166689374) has the molecular formula C28H39N5O7 and a molecular weight of 557.65 g/mol. Its IUPAC name is (Z)-N-[2-[[2-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]-7-methyl-8,11-dioxododec-9-enamide.
| Compound Name | (Z)-N-[2-[[2-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]-7-methyl-8,11-dioxododec-9-enamide |
|---|---|
| PubChem CID | 166689374 |
| Molecular Formula | C28H39N5O7 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | (Z)-N-[2-[[2-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]-7-methyl-8,11-dioxododec-9-enamide |
| SMILES | CC(=O)/C=C\C(=O)C(C)CCCCCC(=O)NCC(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(N)=O |
| InChI | InChI=1S/C28H39N5O7/c1-19(23(35)14-13-20(2)34)9-5-3-8-12-25(37)30-17-26(38)31-18-27(39)33-22(28(40)32-16-24(29)36)15-21-10-6-4-7-11-21/h4,6-7,10-11,13-14,19,22H,3,5,8-9,12,15-18H2,1-2H3,(H2,29,36)(H,30,37)(H,31,38)(H,32,40)(H,33,39)/b14-13-/t19?,22-/m0/s1 |
| InChIKey | ZQRVQJSYOOYBFL-OBPHDLICSA-N |
| XLogP | -0.15 |
| TPSA | 193.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|