C18H35ClN6O3 — CID 171065102
(2S)-N-[(2S)-1-amino-5-[(N'-methylcarbamimidoyl)amino]-1-oxopentan-2-yl]-2-formamidoheptanamide;2-chloroprop-1-ene (PubChem CID 171065102) has the molecular formula C18H35ClN6O3 and a molecular weight of 418.97 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-5-[(N'-methylcarbamimidoyl)amino]-1-oxopentan-2-yl]-2-formamidoheptanamide;2-chloroprop-1-ene.
| Compound Name | (2S)-N-[(2S)-1-amino-5-[(N'-methylcarbamimidoyl)amino]-1-oxopentan-2-yl]-2-formamidoheptanamide;2-chloroprop-1-ene |
|---|---|
| PubChem CID | 171065102 |
| Molecular Formula | C18H35ClN6O3 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-5-[(N'-methylcarbamimidoyl)amino]-1-oxopentan-2-yl]-2-formamidoheptanamide;2-chloroprop-1-ene |
| SMILES | C=C(C)Cl.CCCCC[C@H](NC=O)C(=O)N[C@@H](CCCN/C(N)=N/C)C(N)=O |
| InChI | InChI=1S/C15H30N6O3.C3H5Cl/c1-3-4-5-7-12(20-10-22)14(24)21-11(13(16)23)8-6-9-19-15(17)18-2;1-3(2)4/h10-12H,3-9H2,1-2H3,(H2,16,23)(H,20,22)(H,21,24)(H3,17,18,19);1H2,2H3/t11-,12-;/m0./s1 |
| InChIKey | CAGFBOWHAXFIEW-FXMYHANSSA-N |
| XLogP | 0.72 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|