C24H44N8O9 — CID 175785730
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoic acid (PubChem CID 175785730) has the molecular formula C24H44N8O9 and a molecular weight of 588.66 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 175785730 |
| Molecular Formula | C24H44N8O9 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-5-(carbamoylamino)pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)CNC(=O)CN)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)O)C(C)C |
| InChI | InChI=1S/C24H44N8O9/c1-12(2)8-15(31-21(37)16(11-33)29-18(35)10-28-17(34)9-25)20(36)32-19(13(3)4)22(38)30-14(23(39)40)6-5-7-27-24(26)41/h12-16,19,33H,5-11,25H2,1-4H3,(H,28,34)(H,29,35)(H,30,38)(H,31,37)(H,32,36)(H,39,40)(H3,26,27,41)/t14-,15-,16-,19-/m0/s1 |
| InChIKey | PLMIPDSNRCYYEF-FPXQBCRKSA-N |
| XLogP | -3.77 |
| TPSA | 284.17 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|