C18H27Cl2N7O4 — CID 45263714
(2S,4S)-4-[6-[[amino(nitramido)methylidene]amino]hexanoylamino]-N-(3-chlorophenyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 45263714) has the molecular formula C18H27Cl2N7O4 and a molecular weight of 476.37 g/mol. Its IUPAC name is (2S,4S)-4-[6-[[amino(nitramido)methylidene]amino]hexanoylamino]-N-(3-chlorophenyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-4-[6-[[amino(nitramido)methylidene]amino]hexanoylamino]-N-(3-chlorophenyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 45263714 |
| Molecular Formula | C18H27Cl2N7O4 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (2S,4S)-4-[6-[[amino(nitramido)methylidene]amino]hexanoylamino]-N-(3-chlorophenyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.N/C(=N\CCCCCC(=O)N[C@@H]1CN[C@H](C(=O)Nc2cccc(Cl)c2)C1)N[N+](=O)[O-] |
| InChI | InChI=1S/C18H26ClN7O4.ClH/c19-12-5-4-6-13(9-12)24-17(28)15-10-14(11-22-15)23-16(27)7-2-1-3-8-21-18(20)25-26(29)30;/h4-6,9,14-15,22H,1-3,7-8,10-11H2,(H,23,27)(H,24,28)(H3,20,21,25);1H/t14-,15-;/m0./s1 |
| InChIKey | FVLBPZVBIVOBHQ-YYLIZZNMSA-N |
| XLogP | 1.20 |
| TPSA | 163.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|