C15H26N6O6 — CID 173253609
2-[1-[5-[[amino(nitramido)methylidene]amino]pentanoyl]piperidin-4-yl]ethyl 2-amino-2-oxoacetate (PubChem CID 173253609) has the molecular formula C15H26N6O6 and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-[1-[5-[[amino(nitramido)methylidene]amino]pentanoyl]piperidin-4-yl]ethyl 2-amino-2-oxoacetate.
| Compound Name | 2-[1-[5-[[amino(nitramido)methylidene]amino]pentanoyl]piperidin-4-yl]ethyl 2-amino-2-oxoacetate |
|---|---|
| PubChem CID | 173253609 |
| Molecular Formula | C15H26N6O6 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[1-[5-[[amino(nitramido)methylidene]amino]pentanoyl]piperidin-4-yl]ethyl 2-amino-2-oxoacetate |
| SMILES | NC(=O)C(=O)OCCC1CCN(C(=O)CCCC/N=C(\N)N[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H26N6O6/c16-13(23)14(24)27-10-6-11-4-8-20(9-5-11)12(22)3-1-2-7-18-15(17)19-21(25)26/h11H,1-10H2,(H2,16,23)(H3,17,18,19) |
| InChIKey | QWXZNRXFGBPCMR-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 183.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|