C9H17N5O6 — CID 21120411
(2S)-2-amino-5-[[amino-[(1-carboxy-2-nitroethyl)amino]methylidene]amino]pentanoic acid (PubChem CID 21120411) has the molecular formula C9H17N5O6 and a molecular weight of 291.26 g/mol. Its IUPAC name is (2S)-2-amino-5-[[amino-[(1-carboxy-2-nitroethyl)amino]methylidene]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[amino-[(1-carboxy-2-nitroethyl)amino]methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 21120411 |
| Molecular Formula | C9H17N5O6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2S)-2-amino-5-[[amino-[(1-carboxy-2-nitroethyl)amino]methylidene]amino]pentanoic acid |
| SMILES | N/C(=N\CCC[C@H](N)C(=O)O)NC(C[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H17N5O6/c10-5(7(15)16)2-1-3-12-9(11)13-6(8(17)18)4-14(19)20/h5-6H,1-4,10H2,(H,15,16)(H,17,18)(H3,11,12,13)/t5-,6?/m0/s1 |
| InChIKey | OHLCJEMYQKDXDX-ZBHICJROSA-N |
| XLogP | -2.19 |
| TPSA | 194.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|