C10H15AuN8O6 — CID 162466097
CID 162466097 (PubChem CID 162466097) has the molecular formula C10H15AuN8O6 and a molecular weight of 540.25 g/mol.
| Compound Name | CID 162466097 |
|---|---|
| PubChem CID | 162466097 |
| Molecular Formula | C10H15AuN8O6 |
| Molecular Weight | 540.25 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | — |
| SMILES | N/C(=N\CCC[C@H](NC(=O)OCc1[c-]nn[nH]1)C(=O)O)N[N+](=O)[O-].[Au+] |
| InChI | InChI=1S/C10H15N8O6.Au/c11-9(16-18(22)23)12-3-1-2-7(8(19)20)14-10(21)24-5-6-4-13-17-15-6;/h7H,1-3,5H2,(H,14,21)(H,19,20)(H3,11,12,16)(H,13,15,17);/q-1;+1/t7-;/m0./s1 |
| InChIKey | FYOUCLWCURSYKV-FJXQXJEOSA-N |
| XLogP | -1.84 |
| TPSA | 210.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.25 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|