C21H32AuN4O4P — CID 161212655
CID 161212655 (PubChem CID 161212655) has the molecular formula C21H32AuN4O4P and a molecular weight of 632.45 g/mol.
| Compound Name | CID 161212655 |
|---|---|
| PubChem CID | 161212655 |
| Molecular Formula | C21H32AuN4O4P |
| Molecular Weight | 632.45 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | — |
| SMILES | CC(C)P(C(C)C)C(C)C.O=C(N[C@@H](C(=O)O)c1ccccc1)OCc1[c-]nn[nH]1.[Au+] |
| InChI | InChI=1S/C12H11N4O4.C9H21P.Au/c17-11(18)10(8-4-2-1-3-5-8)14-12(19)20-7-9-6-13-16-15-9;1-7(2)10(8(3)4)9(5)6;/h1-5,10H,7H2,(H,14,19)(H,17,18)(H,13,15,16);7-9H,1-6H3;/q-1;;+1/t10-;;/m1../s1 |
| InChIKey | NFPZAJNHNAIYCW-YQFADDPSSA-N |
| XLogP | 4.35 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|