C18H27AuN4O5P+ — CID 153376095
CID 153376095 (PubChem CID 153376095) has the molecular formula C18H27AuN4O5P+ and a molecular weight of 607.38 g/mol.
| Compound Name | CID 153376095 |
|---|---|
| PubChem CID | 153376095 |
| Molecular Formula | C18H27AuN4O5P+ |
| Molecular Weight | 607.38 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | — |
| SMILES | CC[PH+](CC)CC.O=C(N[C@@H](C(=O)O)c1ccc(O)cc1)OCc1[c-]nn[nH]1.[Au+] |
| InChI | InChI=1S/C12H11N4O5.C6H15P.Au/c17-9-3-1-7(2-4-9)10(11(18)19)14-12(20)21-6-8-5-13-16-15-8;1-4-7(5-2)6-3;/h1-4,10,17H,6H2,(H,14,20)(H,18,19)(H,13,15,16);4-6H2,1-3H3;/q-1;;+1/p+1/t10-;;/m1../s1 |
| InChIKey | RQSSDUICWXAZBZ-YQFADDPSSA-O |
| XLogP | 2.62 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|