C16H19N5O6S3 — CID 23654422
5-[[amino(nitramido)methylidene]amino]-2-[[4-(5-sulfanylidenedithiolan-3-yl)phenoxy]carbonylamino]pentanoic acid (PubChem CID 23654422) has the molecular formula C16H19N5O6S3 and a molecular weight of 473.56 g/mol. Its IUPAC name is 5-[[amino(nitramido)methylidene]amino]-2-[[4-(5-sulfanylidenedithiolan-3-yl)phenoxy]carbonylamino]pentanoic acid.
| Compound Name | 5-[[amino(nitramido)methylidene]amino]-2-[[4-(5-sulfanylidenedithiolan-3-yl)phenoxy]carbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 23654422 |
| Molecular Formula | C16H19N5O6S3 |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 5-[[amino(nitramido)methylidene]amino]-2-[[4-(5-sulfanylidenedithiolan-3-yl)phenoxy]carbonylamino]pentanoic acid |
| SMILES | N/C(=N\CCCC(NC(=O)Oc1ccc(C2CC(=S)SS2)cc1)C(=O)O)N[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N5O6S3/c17-15(20-21(25)26)18-7-1-2-11(14(22)23)19-16(24)27-10-5-3-9(4-6-10)12-8-13(28)30-29-12/h3-6,11-12H,1-2,7-8H2,(H,19,24)(H,22,23)(H3,17,18,20) |
| InChIKey | CZTGOGSRONZJNR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|