C13H19N5O4 — CID 166597384
2-(benzylamino)-5-(diaminomethylideneamino)-4-nitropentanoic acid (PubChem CID 166597384) has the molecular formula C13H19N5O4 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-(benzylamino)-5-(diaminomethylideneamino)-4-nitropentanoic acid.
| Compound Name | 2-(benzylamino)-5-(diaminomethylideneamino)-4-nitropentanoic acid |
|---|---|
| PubChem CID | 166597384 |
| Molecular Formula | C13H19N5O4 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-(benzylamino)-5-(diaminomethylideneamino)-4-nitropentanoic acid |
| SMILES | NC(N)=NCC(CC(NCc1ccccc1)C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N5O4/c14-13(15)17-8-10(18(21)22)6-11(12(19)20)16-7-9-4-2-1-3-5-9/h1-5,10-11,16H,6-8H2,(H,19,20)(H4,14,15,17) |
| InChIKey | BYWDHWRLYVYSFJ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|